Predict the products of the following reactions:

(i)

(ii)

(iii)

(iv)

Give simple chemical tests to distinguish between the following pairs of compounds.

(i) Propanal and Propanone

(ii) Acetophenone and Benzophenone

(iii) Phenol and Benzoic acid

(iv) Benzoic acid and Ethyl benzoate

(v) Pentan-2-one and Pentan-3-one

(vi) Benzaldehyde and Acetophenone

(vii) Ethanal and Propanal

A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL^-1, then what shall be the molarity of the solution?

Henry's law constant for CO₂ in water is 1.67 x 10⁸Pa at 298 K. Calculate the quantity of CO₂in 500 mL of soda water when packed under 2.5 atm CO₂ pressure at 298 K.

Calculate the mass of a non-volatile solute (molar mass 40 g mol^-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.

How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na₂CO₃ and NaHCO₃ containing equimolar amounts of both?

If NaCl is doped with 10^-3mol % of SrCl₂, what is the concentration of cation vacancies?

Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions.

(i)Ethanal, Propanal, Propanone, Butanone.

(ii)Benzaldehyde, p-Tolualdehyde, p-Nitrobenzaldehyde, Acetophenone.

Hint:Consider steric effect and electronic effect.

What is shape selective catalysis?

Explain why Cu⁺ ion is not stable in aqueous solutions?

A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL^-1, then what shall be the molarity of the solution?

The following results have been obtained during the kinetic studies of the reaction: 2A + B → C + D

Determine the rate law and the rate constant for the reaction.

Name a substance which can be used as an antiseptic as well as disinfectant.

Give the IUPAC names of the following compounds:

(i) PhCH₂CH₂COOH         (ii) (CH₃)₂C=CHCOOH

(iii)             (iv)

Out of C₆H₅CH₂Cl and C₆H₅CHClC₆H₅, which is more easily hydrolysed by aqueous KOH?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Calculate the standard cell potentials of galvanic cells in which the following reactions take place:

(i) 2Cr(s) + 3Cd²⁺(aq) → 2Cr³⁺(aq) + 3Cd

(ii) Fe²⁺(aq) + Ag+(aq) → Fe³⁺(aq) + Ag(s)

Calculate the ΔrG^ø¸ and equilibrium constant of the reactions.