Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
(i) 4-methylpentanal
(ii) 6-Chloro-4-ethylhexan-3-one
(iii) But-2-en-1-al
(iv) Pentane-2,4-dione
(v) 3,3,5-Trimethylhexan-2-one
(vi) 3,3-Dimethylbutanoic acid
(vii) Benzene-1,4-dicarbaldehyde
Give simple chemical tests to distinguish between the following pairs of compounds.
(i) Propanal and Propanone
(ii) Acetophenone and Benzophenone
(iii) Phenol and Benzoic acid
(iv) Benzoic acid and Ethyl benzoate
(v) Pentan-2-one and Pentan-3-one
(vi) Benzaldehyde and Acetophenone
(vii) Ethanal and Propanal
A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.
How the following conversions can be carried out?
(i) Propene to propan-1-ol
(ii) Ethanol to but-1-yne
(iii) 1-Bromopropane to 2-bromopropane
(iv) Toluene to benzyl alcohol
(v) Benzene to 4-bromonitrobenzene
(vi) Benzyl alcohol to 2-phenylethanoic acid
(vii) Ethanol to propanenitrile
(viii) Aniline to chlorobenzene
(ix) 2-Chlorobutane to 3, 4-dimethylhexane
(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane
(xi) Ethyl chloride to propanoic acid
(xii) But-1-ene to n-butyliodide
(xiii) 2-Chloropropane to 1-propanol
(xiv) Isopropyl alcohol to iodoform
(xv) Chlorobenzene to p-nitrophenol
(xvi) 2-Bromopropane to 1-bromopropane
(xvii) Chloroethane to butane
(xviii) Benzene to diphenyl
(xix) tert-Butyl bromide to isobutyl bromide
(xx) Aniline to phenylisocyanide
A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL-1, then what shall be the molarity of the solution?
Henry's law constant for CO2 in water is 1.67 x 108Pa at 298 K. Calculate the quantity of CO2in 500 mL of soda water when packed under 2.5 atm CO2 pressure at 298 K.
Calculate the mass of a non-volatile solute (molar mass 40 g mol-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.
The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.
Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.
How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na2CO3 and NaHCO3 containing equimolar amounts of both?
If NaCl is doped with 10-3mol % of SrCl2, what is the concentration of cation vacancies?
Vapour pressure of water at 293 Kis 17.535 mm Hg. Calculate the vapour pressure of water at 293 Kwhen 25 g of glucose is dissolved in 450 g of water.
Write the isomers of the compound having formula C4H9Br.
Which one of the following does not exist?
(i) XeOF4
(ii) NeF2
(iii) XeF2
(iv) XeF6
Knowing the electron gain enthalpy values for O → O- and O → O2- as -141 and 702 kJ mol-1 respectively, how can you account for the formation of a large number of oxides having O2- species and not O-? (Hint: Consider lattice energy factor in the formation of compounds).
What are the oxidation states of phosphorus in the following:
(i) H3PO3
(ii) PCl3
(iii) Ca3P2
(iv) Na3PO4
(v) POF3?
Why is use of aspartame limited to cold foods and drinks?
Compare the chemistry of the actinoids with that of lanthanoids with reference to:
(i) electronic configuration
(ii) oxidation states and
(iii) chemical reactivity.
The partial pressure of ethane over a solution containing 6.56 x 10-3 g of ethane is 1 bar. If the solution contains 5.00 x 10-2 g of ethane, then what shall be the partial pressure of the gas?
[NiCl4]2- is paramagnetic while [Ni(CO)4] is diamagnetic though both are tetrahedral. Why?
Complete the following acid-base reactions and name the products:
(i) CH3CH2CH2NH2 + HCl →
(ii) (C2H5)3N + HCl →
nice work sarah