Predict the products formed when cyclohe | Class 12 Chemistry Chapter Aldehydes Ketones and Carboxylic Acids, Aldehydes Ketones and Carboxylic Acids NCERT Solutions

Which acid of each pair shown here would you expect to be stronger?

(i) CH₃CO₂H or CH₂FCO₂H

(ii)CH₂FCO₂H or CH₂ClCO₂H

(iii) CH₂FCH₂CH₂CO₂H or CH₃CHFCH₂CO₂H

(iv)

Predict the products of the following reactions:

(i)

(ii)

(iii)

(iv)

Although phenoxide ion has more number of resonating structures than carboxylate ion, carboxylic acid is a stronger acid than phenol. Why?

Give plausible explanation for each of the following:

(i) Cyclohexanone forms cyanohydrin in good yield but 2, 2, 6 trimethylcyclohexanone does not.

(ii) There are two -NH₂ groups in semicarbazide. However, only one is involved in the formation of semicarbazones.

(iii) During the preparation of esters from a carboxylic acid and an alcohol in the presence of an acid catalyst, the water or the ester should be removed as soon as it is formed.

Arrange the following compounds in increasing order of their property as indicated:

(i) Acetaldehyde, Acetone, Di-tert-butyl ketone, Methyl tert-butyl ketone (reactivity towards HCN)

(ii) CH₃CH₂CH(Br)COOH, CH₃CH(Br)CH₂COOH, (CH₃)₂CHCOOH, CH₃CH₂CH₂COOH (acid strength)

(iii) Benzoic acid, 4-Nitrobenzoic acid, 3,4-Dinitrobenzoic acid, 4-Methoxybenzoic acid (acid strength)

An organic compound with the molecular formula C₉H₁₀O forms 2, 4-DNP derivative, reduces Tollens' reagent and undergoes Cannizzaro reaction. On vigorous oxidation, it gives 1, 2-benzenedicarboxylic acid. Identify the compound.

Write structural formulas and names of four possible aldol condensation products from propanal and butanal. In each case, indicate which aldehyde acts as nucleophile and which as electrophile.

How will you convert ethanal into the following compounds?

(i) Butane-1, 3-diol  (ii) But-2-enal  (iii) But-2-enoic acid

Which of the following compounds would undergo aldol condensation, which the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction.

(i) Methanal                       (ii) 2-Methylpentanal

(iii) Benzaldehyde              (iv) Benzophenone

(v) Cyclohexanone             (vi) 1-Phenylpropanone

(vii) Phenylacetaldehyde     (viii) Butan-1-ol

(ix) 2, 2-Dimethylbutanal

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.

A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL^-1, then what shall be the molarity of the solution?

Henry's law constant for CO₂ in water is 1.67 x 10⁸Pa at 298 K. Calculate the quantity of CO₂in 500 mL of soda water when packed under 2.5 atm CO₂ pressure at 298 K.

Calculate the mass of a non-volatile solute (molar mass 40 g mol^-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.

How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na₂CO₃ and NaHCO₃ containing equimolar amounts of both?

If NaCl is doped with 10^-3mol % of SrCl₂, what is the concentration of cation vacancies?

H₂S, a toxic gas with rotten egg like smell, is used for the qualitative analysis. If the solubility of H₂S in water at STP is 0.195 m, calculate Henry's law constant.

Henry's law constant for CO₂ in water is 1.67 x 10⁸Pa at 298 K. Calculate the quantity of CO₂in 500 mL of soda water when packed under 2.5 atm CO₂ pressure at 298 K.

What are nucleic acids? Mention their two important functions.

What are the different oxidation states exhibited by the lanthanoids?

The reaction between A and B is first order with respect to A and zero order with respect to B. Fill in the blanks in the following table:

Mention the conditions required to maximise the yield of ammonia.

Ionic solids conduct electricity in molten state but not in solid state. Explain.

Describe the oxidising action of potassium dichromate and write the ionicequations for its reaction with:

(i) iodide

(ii) iron

(II) solution and

(iii) H₂S

What type of solids are electrical conductors, malleable and ductile?

Write the structure of the major organic product in each of the following reactions:

Ferric oxide crystallises in a hexagonal close-packed array of oxide ions with two out of every three octahedral holes occupied by ferric ions. Derive the formula of the ferric oxide.