Class 12th Chemistry 2017 Set3 Delhi Board Paper Solution

Give simple chemical tests to distinguish between the following pairs of compounds.

(i) Propanal and Propanone

(ii) Acetophenone and Benzophenone

(iii) Phenol and Benzoic acid

(iv) Benzoic acid and Ethyl benzoate

(v) Pentan-2-one and Pentan-3-one

(vi) Benzaldehyde and Acetophenone

(vii) Ethanal and Propanal

A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL^-1, then what shall be the molarity of the solution?

Henry's law constant for CO₂ in water is 1.67 x 10⁸Pa at 298 K. Calculate the quantity of CO₂in 500 mL of soda water when packed under 2.5 atm CO₂ pressure at 298 K.

Calculate the mass of a non-volatile solute (molar mass 40 g mol^-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.

How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na₂CO₃ and NaHCO₃ containing equimolar amounts of both?

If NaCl is doped with 10^-3mol % of SrCl₂, what is the concentration of cation vacancies?

Two elements A and B form compounds having formula AB₂ and AB₄. When dissolved in 20 g of benzene (C₆H₆), 1 g of AB₂ lowers the freezing point by 2.3 Kwhereas 1.0 g of AB₄ lowers it by 1.3 K. The molar depression constant for benzene is 5.1 Kkg mol^-1. Calculate atomic masses of A and B.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Discuss the main purpose of vulcanisation of rubber.

Give the oxidation state, d-orbital occupation and coordination number of the central metal ion in the following complexes:

(i) K₃[Co(C₂O₄)₃]

(ii) cis-[Cr(en)₂Cl₂]Cl

(iii) (NH₄)₂[CoF₄]

(iv) [Mn(H₂O)₆]SO₄

Give four uses of emulsions.

Give the uses of freon 12, DDT, carbon tetrachloride and iodoform.

For the reaction:

2A + B → A₂B

the rate = k[A][B]²with k= 2.0 x 10^-6mol^-2L²s^-1. Calculate the initial rate of the reaction when [A] = 0.1 mol L^-1, [B] = 0.2 mol L^-1. Calculate the rate of reaction after [A] is reduced to 0.06 mol L^-1.

Why does nitrogen show catenation properties less than phosphorus?

Name the reagents used in the following reactions:

(i) Oxidation of a primary alcohol to carboxylic acid.

(ii) Oxidation of a primary alcohol to aldehyde.

(iii) Bromination of phenol to 2,4,6-tribromophenol.

(iv) Benzyl alcohol to benzoic acid.

(v) Dehydration of propan-2-ol to propene.

(vi) Butan-2-one to butan-2-ol.

The experimental data for decomposition of N₂O₅

[2N₂O₅ → 4NO₂ + O₂]

in gas phase at 318K are given below:

(i) Plot [N₂O₅] against t.

(ii) Find the half-life period for the reaction.

(iii) Draw a graph between log[N₂O₅] and t.

(iv) What is the rate law ?

(v) Calculate the rate constant.

(vi) Calculate the half-life period from k and compare it with (ii).