Which one of the following has the highest dipole moment?
(i) CH2Cl2
(ii) CHCl3
(iii) CCl4
CCl4 is a symmetrical molecule. Therefore, the dipole moments of all four C-Cl bonds cancel each other. Hence, its resultant dipole moment is zero.
As shown in the above figure, in CHCl3, the resultant of dipole moments of two C-Cl bonds is opposed by the resultant of dipole moments of one C-H bond and one C-Cl bond. Since the resultant of one C-H bond and one C-Cl bond dipole moments is smaller than two C-Cl bonds, the opposition is to a small extent. As a result, CHCl3 has a small dipole moment of 1.08 D.
On the other hand, in case of CH2Cl2, the resultant of the dipole moments of two C-Cl bonds is strengthened by the resultant of the dipole moments of two C-H bonds. As a result, CH2Cl2 has a higher dipole moment of 1.60 D than CHCl3 i.e., CH2Cl2 has the highest dipole moment.
Hence, the given compounds can be arranged in the increasing order of their dipole moments as:
CCl4 < CHCl3 < CH2Cl2
How the following conversions can be carried out?
(i) Propene to propan-1-ol
(ii) Ethanol to but-1-yne
(iii) 1-Bromopropane to 2-bromopropane
(iv) Toluene to benzyl alcohol
(v) Benzene to 4-bromonitrobenzene
(vi) Benzyl alcohol to 2-phenylethanoic acid
(vii) Ethanol to propanenitrile
(viii) Aniline to chlorobenzene
(ix) 2-Chlorobutane to 3, 4-dimethylhexane
(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane
(xi) Ethyl chloride to propanoic acid
(xii) But-1-ene to n-butyliodide
(xiii) 2-Chloropropane to 1-propanol
(xiv) Isopropyl alcohol to iodoform
(xv) Chlorobenzene to p-nitrophenol
(xvi) 2-Bromopropane to 1-bromopropane
(xvii) Chloroethane to butane
(xviii) Benzene to diphenyl
(xix) tert-Butyl bromide to isobutyl bromide
(xx) Aniline to phenylisocyanide
Arrange each set of compounds in order of increasing boiling points.
(i) Bromomethane, Bromoform, Chloromethane, Dibromomethane.
(ii) 1-Chloropropane, Isopropyl chloride, 1-Chlorobutane.
What happens when
(i) n-butyl chloride is treated with alcoholic KOH,
(ii) bromobenzene is treated with Mg in the presence of dry ether,
(iii) chlorobenzene is subjected to hydrolysis,
(iv) ethyl chloride is treated with aqueous KOH,
(v) methyl bromide is treated with sodium in the presence of dry ether,
(vi) methyl chloride is treated with KCN.
Among the isomeric alkanes of molecular formula C5H12, identify the one that on photochemical chlorination yields
(i) A single monochloride.
(ii) Three isomeric monochlorides.
(iii) Four isomeric monochlorides.
Write structures of different dihalogen derivatives of propane.
Arrange the compounds of each set in order of reactivity towards SN2 displacement:
(i) 2-Bromo-2-methylbutane, 1-Bromopentane, 2-Bromopentane
(ii) 1-Bromo-3-methylbutane, 2-Bromo-2-methylbutane, 3-Bromo-2- methylbutane
(iii) 1-Bromobutane, 1-Bromo-2,2-dimethylpropane, 1-Bromo-2-methylbutane, 1-Bromo-3-methylbutane.
The treatment of alkyl chlorides with aqueous KOH leads to the formation of alcohols but in the presence of alcoholic KOH, alkenes are major products. Explain.
Primary alkyl halide C4H9Br (a) reacted with alcoholic KOH to give compound (b).Compound (b) is reacted with HBr to give (c) which is an isomer of (a). When (a) is reacted with sodium metal it gives compound (d), C8H18 which is different from the compound formed when n-butyl bromide is reacted with sodium. Give the structural formula of (a) and write the equations for all the reactions.
Why is sulphuric acid not used during the reaction of alcohols with KI?
In the following pairs of halogen compounds, which compound undergoes faster SN1 reaction?
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
H2S, a toxic gas with rotten egg like smell, is used for the qualitative analysis. If the solubility of H2S in water at STP is 0.195 m, calculate Henry's law constant.
How much electricity in terms of Faraday is required to produce
(i) 20.0 g of Ca from molten CaCl2.
(ii) 40.0 g of Al from molten Al2O3.
Write the chemical equation for preparing sodium soap from glyceryl oleate and glyceryl palmitate. Structural formulae of these compounds are given below.
(i) (C15H31COO)3 C3H5 - Glyceryl palmitate
(ii)(C17H33COO)3 C3H5 - Glyceryl oleate
How is O3 estimated quantitatively?
Write the IUPAC names of the following ketones and aldehydes. Wherever possible, give also common names.
(i) CH3CO(CH2)4CH3 (ii) CH3CH2CHBrCH2CH(CH3)CHO
(iii) CH3(CH2)5CHO (iv) Ph-CH=CH-CHO
(v) (vi) PhCOPh
Write the mechanism of the reaction of HI with methoxymethane.
Why do we require artificial sweetening agents?
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Using IUPAC norms write the formulas for the following:
(i) Tetrahydroxozincate(II)
(ii) Potassium tetrachloridopalladate(II)
(iii) Diamminedichloridoplatinum(II)
(iv) Potassium tetracyanonickelate(II)
(v) Pentaamminenitrito-O-cobalt(III)
(vi) Hexaamminecobalt(III) sulphate
(vii) Potassium tri(oxalato)chromate(III)
(viii) Hexaammineplatinum(IV)
(ix) Tetrabromidocuprate(II)
(x) Pentaamminenitrito-N-cobalt(III)
Predict the major product of acid catalysed dehydration of
(i) 1-Methylcyclohexanol and
(ii) Butan-1-ol
Very very good
Superb website!
very nice