Class 12 Chemistry - Chapter The d-and f-Block Elements NCERT Solutions | Why are Mn2+compounds more stable than F

Explain why Cu⁺ ion is not stable in aqueous solutions?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

The E^θ(M²⁺/M) value for copper is positive (+0.34V). What is possibly the reason for this? (Hint: consider its high Δ_aHV and low Δ_hydHV)

How would you account for the following:

(i) Of the d⁴ species, Cr²⁺ is strongly reducing while manganese (III) is strongly oxidising.

(ii) Cobalt (II) is stable in aqueous solution but in the presence of complexing reagents it is easily oxidised.

(iii) The d¹ configuration is very unstable in ions.

Actinoid contraction is greater from element to element than lanthanoid contraction. Why?

Which is a stronger reducing agent Cr²⁺ or Fe²⁺ and why?

Explain giving reasons:

(i) Transition metals and many of their compounds show paramagnetic behaviour.

(ii) The enthalpies of atomisation of the transition metals are high.

(iii) The transition metals generally form coloured compounds.

(iv) Transition metals and their many compounds act as good catalyst.

Give examples and suggest reasons for the following features of the transition metal chemistry:

(i)The lowest oxide of transition metal is basic, the highest is amphoteric/acidic.

(ii)A transition metal exhibits highest oxidation state in oxides and fluorides.

(iii) The highest oxidation state is exhibited in oxoanions of a metal.

Predict which of the following will be coloured in aqueous solution?

Ti³⁺, V³⁺, Cu⁺, Sc³⁺, Mn²⁺, Fe³⁺ and Co²⁺.

Give reasons for each.

Describe the preparation of potassium dichromate from iron chromite ore. What is the effect of increasing pH on a solution of potassium dichromate?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

While separating a mixture of ortho and para nitrophenols by steam distillation, name the isomer which will be steam volatile. Give reason.

Using IUPAC norms write the formulas for the following:

(i) Tetrahydroxozincate(II)

(ii) Potassium tetrachloridopalladate(II)

(iii) Diamminedichloridoplatinum(II)

(iv) Potassium tetracyanonickelate(II)

(v) Pentaamminenitrito-O-cobalt(III)

(vi) Hexaamminecobalt(III) sulphate

(vii) Potassium tri(oxalato)chromate(III)

(viii) Hexaammineplatinum(IV)

(ix) Tetrabromidocuprate(II)

(x) Pentaamminenitrito-N-cobalt(III)

Mention the factors that affect the rate of a chemical reaction.

Give reason for the higher boiling point of ethanol in comparison to methoxymethane.

Name the parameters that characterize a unit cell.

How will you convert:

(i) Ethanoic acid into methanamine

(ii) Hexanenitrile into 1-aminopentane

(iii) Methanol to ethanoic acid

(iv) Ethanamine into methanamine

(v) Ethanoic acid into propanoic acid

(vi) Methanamine into ethanamine

(vii) Nitromethane into dimethylamine

(viii) Propanoic acid into ethanoic acid

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Predict the products of the following reactions:

(i)

(ii)

(iii)

(iv)

Distinguish between

(i)Hexagonal and monoclinic unit cells

(ii) Face-centred and end-centred unit cells.

Show how are the following alcohols prepared by the reaction of a suitable

Grignard reagent on methanal?

(i)

(ii)