Class 12 Chemistry - Chapter Alcohols Phenols and Ethers NCERT Solutions | While separating a mixture of ortho and

Explain the following with an example.

(i) Kolbe's reaction.

(ii) Reimer-Tiemann reaction.

(iii) Williamson ether synthesis.

(iv) Unsymmetrical ether.

How are the following conversions carried out?

(i) Propene → Propan-2-ol

(ii) Benzyl chloride → Benzyl alcohol

(iii) Ethyl magnesium chloride → Propan-1-ol.

(iv) Methyl magnesium bromide → 2-Methylpropan-2-ol.

Write the mechanism of acid-catalysed dehydration of ethanol to yield ethene.

Give the equations of reactions for the preparation of phenol from cumene.

Write equations of the following reactions:

(i) Friedel-Crafts reaction-alkylation of anisole.

(ii) Nitration of anisole.

(iii) Bromination of anisole in ethanoic acid medium.

(iv) Friedel-Craft's acetylation of anisole.

Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?

Give two reactions that show the acidic nature of phenol. Compare acidity of phenol with that of ethanol.

Show how are the following alcohols prepared by the reaction of a suitable

Grignard reagent on methanal?

(i)

(ii)

Write the reactions of Williamson synthesis of 2-ethoxy-3-methylpentane starting from ethanol and 3-methylpentan-2-ol.

What is meant by hydroboration-oxidation reaction? Illustrate it with an example.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Using IUPAC norms write the formulas for the following:

(i) Tetrahydroxozincate(II)

(ii) Potassium tetrachloridopalladate(II)

(iii) Diamminedichloridoplatinum(II)

(iv) Potassium tetracyanonickelate(II)

(v) Pentaamminenitrito-O-cobalt(III)

(vi) Hexaamminecobalt(III) sulphate

(vii) Potassium tri(oxalato)chromate(III)

(viii) Hexaammineplatinum(IV)

(ix) Tetrabromidocuprate(II)

(x) Pentaamminenitrito-N-cobalt(III)

Mention the factors that affect the rate of a chemical reaction.

Name the parameters that characterize a unit cell.

How will you convert:

(i) Ethanoic acid into methanamine

(ii) Hexanenitrile into 1-aminopentane

(iii) Methanol to ethanoic acid

(iv) Ethanamine into methanamine

(v) Ethanoic acid into propanoic acid

(vi) Methanamine into ethanamine

(vii) Nitromethane into dimethylamine

(viii) Propanoic acid into ethanoic acid

Actinoid contraction is greater from element to element than lanthanoid contraction. Why?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Predict the products of the following reactions:

(i)

(ii)

(iii)

(iv)

Distinguish between

(i)Hexagonal and monoclinic unit cells

(ii) Face-centred and end-centred unit cells.

Explain why Cu⁺ ion is not stable in aqueous solutions?

Vapour pressure of pure water at 298 K is 23.8 mm Hg. 50 g of urea (NH₂CONH₂) is dissolved in 850 g of water. Calculate the vapour pressure of water for this solution and its relative lowering.