Class 12 Chemistry - Chapter Surface Chemistry NCERT Solutions | Action of soap is due to emulsification

Explain what is observed

(i) When a beam of light is passed through a colloidal sol.

(ii) An electrolyte, NaCl is added to hydrated ferric oxide sol.

(iii) Electric current is passed through a colloidal sol?

Why is adsorption always exothermic?

What do you mean by activity and selectivity of catalysts?

What modification can you suggest in the Hardy-Schulze law?

Explain the following terms:

(i) Electrophoresis

(ii) Coagulation

(iii) Dialysis

(iv) Tyndall effect.

What is an adsorption isotherm? Describe Freundlich adsorption isotherm.

Explain the terms with suitable examples:

(i) Alcosol

(ii) Aerosol

(iii) Hydrosol

How are colloids classified on the basis of

(i) Physical states of components

(ii) Nature of dispersion medium and

(iii) Interaction between dispersed phase and dispersion medium?

Discuss the effect of pressure and temperature on the adsorption of gases on solids.

Why does physisorption decrease with the increase of temperature

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

A first order reaction takes 40 min for 30% decomposition. Calculate t_1/2.

While separating a mixture of ortho and para nitrophenols by steam distillation, name the isomer which will be steam volatile. Give reason.

Why are Mn²⁺compounds more stable than Fe²⁺ towards oxidation to their +3 state?

Using IUPAC norms write the formulas for the following:

(i) Tetrahydroxozincate(II)

(ii) Potassium tetrachloridopalladate(II)

(iii) Diamminedichloridoplatinum(II)

(iv) Potassium tetracyanonickelate(II)

(v) Pentaamminenitrito-O-cobalt(III)

(vi) Hexaamminecobalt(III) sulphate

(vii) Potassium tri(oxalato)chromate(III)

(viii) Hexaammineplatinum(IV)

(ix) Tetrabromidocuprate(II)

(x) Pentaamminenitrito-N-cobalt(III)

Mention the factors that affect the rate of a chemical reaction.

Give reason for the higher boiling point of ethanol in comparison to methoxymethane.

Name the parameters that characterize a unit cell.

How will you convert:

(i) Ethanoic acid into methanamine

(ii) Hexanenitrile into 1-aminopentane

(iii) Methanol to ethanoic acid

(iv) Ethanamine into methanamine

(v) Ethanoic acid into propanoic acid

(vi) Methanamine into ethanamine

(vii) Nitromethane into dimethylamine

(viii) Propanoic acid into ethanoic acid

Actinoid contraction is greater from element to element than lanthanoid contraction. Why?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p