Class 12 Chemistry - Chapter The Solid State NCERT Solutions | Copper crystallises into a fcc lattice w

If NaCl is doped with 10^-3mol % of SrCl₂, what is the concentration of cation vacancies?

A cubic solid is made of two elements P and Q. Atoms of Q are at the corners of the cube and P at the body-centre. What is the formula of the compound? What are the coordination numbers of P and Q?

An element with molar mass 2.7 x 10^-2kg mol^-1 forms a cubic unit cell with edge length 405 pm. If its density is 2.7 x 10³ kg m^-3, what is the nature of the cubic unit cell?

A compound is formed by two elements M and N. The element N forms ccp and atoms of M occupy 1/3^rd of tetrahedral voids. What is the formula of the compound?

Aluminium crystallises in a cubic close-packed structure. Its metallic radius is 125 pm.

(i) What is the length of the side of the unit cell?

(ii) How many unit cells are there in 1.00 cm3of aluminium?

Analysis shows that nickel oxide has the formula Ni_0.98 O_1.00. What fractions of nickel exist as Ni²⁺and Ni³⁺ions?

Distinguish between

(i)Hexagonal and monoclinic unit cells

(ii) Face-centred and end-centred unit cells.

Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?

Ionic solids, which have anionic vacancies due to metal excess defect, develop colour. Explain with the help of a suitable example.

How will you distinguish between the following pairs of terms:

(i) Hexagonal close-packing and cubic close-packing?

(ii) Crystal lattice and unit cell?

(iii) Tetrahedral void and octahedral void?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Why is the ester hydrolysis slow in the beginning and becomes faster after sometime?

A first order reaction takes 40 min for 30% decomposition. Calculate t_1/2.

The conversion of molecules X to Y follows second order kinetics. If concentration of X is increased to three times how will it affect the rate of formation of Y?

Complete the following acid-base reactions and name the products:

(i) CH₃CH₂CH₂NH₂ + HCl →

(ii) (C₂H₅)₃N + HCl →

Explain the bonding in coordination compounds in terms of Werner’s postulates.

The decomposition of A into product has value of k as 4.5 x 10³ s^-1 at 10°C and energy of activation 60 kJ mol^-1. At what temperature would k be 1.5 x 10⁴ s^-1?

Describe some features of catalysis by zeolites.

What is the effect of temperature on the rate constant of a reaction? How can this temperature effect on rate constant be represented quantitatively?

What is meant by hydroboration-oxidation reaction? Illustrate it with an example.