Ferric oxide crystallises in a hexagonal close-packed array of oxide ions with two out of every three octahedral holes occupied by ferric ions. Derive the formula of the ferric oxide.
There are one octahedral hole for each atom in hexagonal close packed arrangement. If the no. of oxide ions per unit cell = 1.
then no. of fe3+ ions = 2/3 x octahedual holes
= 2/3 x 1 = 2/3
formula of the compound = fe2/3 O1 or fe2O3
If NaCl is doped with 10-3mol % of SrCl2, what is the concentration of cation vacancies?
A cubic solid is made of two elements P and Q. Atoms of Q are at the corners of the cube and P at the body-centre. What is the formula of the compound? What are the coordination numbers of P and Q?
An element with molar mass 2.7 x 10-2kg mol-1 forms a cubic unit cell with edge length 405 pm. If its density is 2.7 x 103 kg m-3, what is the nature of the cubic unit cell?
Copper crystallises into a fcc lattice with edge length 3.61 x 10-8cm. Show that the calculated density is in agreement with its measured value of 8.92 g cm-3.
A compound is formed by two elements M and N. The element N forms ccp and atoms of M occupy 1/3rd of tetrahedral voids. What is the formula of the compound?
Aluminium crystallises in a cubic close-packed structure. Its metallic radius is 125 pm.
(i) What is the length of the side of the unit cell?
(ii) How many unit cells are there in 1.00 cm3of aluminium?
Analysis shows that nickel oxide has the formula Ni0.98 O1.00. What fractions of nickel exist as Ni2+and Ni3+ions?
Distinguish between
(i)Hexagonal and monoclinic unit cells
(ii) Face-centred and end-centred unit cells.
Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?
Ionic solids, which have anionic vacancies due to metal excess defect, develop colour. Explain with the help of a suitable example.
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
The air is a mixture of a number of gases. The major components are oxygen and nitrogen with approximate proportion of 20% is to 79% by volume at 298 K. The water is in equilibrium with air at a pressure of 10 atm. At 298 Kif the Henry's law constants for oxygen and nitrogen are 3.30 x 107 mm and 6.51 x 107mm respectively, calculate the composition of these gases in water.
Write the IUPAC names of the following ketones and aldehydes. Wherever possible, give also common names.
(i) CH3CO(CH2)4CH3 (ii) CH3CH2CHBrCH2CH(CH3)CHO
(iii) CH3(CH2)5CHO (iv) Ph-CH=CH-CHO
(v) (vi) PhCOPh
An aqueous solution of 2% non-volatile solute exerts a pressure of 1.004 bar at the normal boiling point of the solvent. What is the molar mass of the solute?
A sample of drinking water was found to be severely contaminated with chloroform (CHCl3) supposed to be a carcinogen. The level of contamination was 15 ppm (by mass):
(i) express this in percent by mass
(ii) determine the molality of chloroform in the water sample.
Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.
How the following conversions can be carried out?
(i) Propene to propan-1-ol
(ii) Ethanol to but-1-yne
(iii) 1-Bromopropane to 2-bromopropane
(iv) Toluene to benzyl alcohol
(v) Benzene to 4-bromonitrobenzene
(vi) Benzyl alcohol to 2-phenylethanoic acid
(vii) Ethanol to propanenitrile
(viii) Aniline to chlorobenzene
(ix) 2-Chlorobutane to 3, 4-dimethylhexane
(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane
(xi) Ethyl chloride to propanoic acid
(xii) But-1-ene to n-butyliodide
(xiii) 2-Chloropropane to 1-propanol
(xiv) Isopropyl alcohol to iodoform
(xv) Chlorobenzene to p-nitrophenol
(xvi) 2-Bromopropane to 1-bromopropane
(xvii) Chloroethane to butane
(xviii) Benzene to diphenyl
(xix) tert-Butyl bromide to isobutyl bromide
(xx) Aniline to phenylisocyanide
Write short notes on the following:
(i) Carbylamine reaction (ii) Diazotisation
(iii) Hofmann's bromamide reaction (iv) Coupling reaction
(v) Ammonolysis (vi) Acetylation
(vii) Gabriel phthalimide synthesis.
Name the macromolecules that are chosen as drug targets.
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
What are the expected products of hydrolysis of lactose?