Arrange each set of compounds in order of increasing boiling points.
(i) Bromomethane, Bromoform, Chloromethane, Dibromomethane.
(ii) 1-Chloropropane, Isopropyl chloride, 1-Chlorobutane.
(i)
For alkyl halides containing the same alkyl group, the boiling point increases with an increase in the atomic mass of the halogen atom.
Since the atomic mass of Br is greater than that of Cl, the boiling point of bromomethane is higher than that of chloromethane.
Further, for alkyl halides containing the same alkyl group, the boiling point increases with an increase in the number of halides. Therefore, the boiling point of Dibromomethane is higher than that of chloromethane and bromomethane, but lower than that of bromoform.
Hence, the given set of compounds can be arranged in the order of their increasing boiling points as:
Chloromethane < Bromomethane < Dibromomethane < Bromoform.
(ii)
For alkyl halides containing the same halide, the boiling point increases with an increase in the size of the alkyl group. Thus, the boiling point of 1-chlorobutane is higher than that of isopropyl chloride and 1-chloropropane.
Further, the boiling point decreases with an increase in branching in the chain. Thus, the boiling point of isopropyl alcohol is lower than that of 1-chloropropane.
Hence, the given set of compounds can be arranged in the increasing order of their boiling points as:
Isopropyl chloride < 1-Chloropropane < 1-Chlorobutane
How the following conversions can be carried out?
(i) Propene to propan-1-ol
(ii) Ethanol to but-1-yne
(iii) 1-Bromopropane to 2-bromopropane
(iv) Toluene to benzyl alcohol
(v) Benzene to 4-bromonitrobenzene
(vi) Benzyl alcohol to 2-phenylethanoic acid
(vii) Ethanol to propanenitrile
(viii) Aniline to chlorobenzene
(ix) 2-Chlorobutane to 3, 4-dimethylhexane
(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane
(xi) Ethyl chloride to propanoic acid
(xii) But-1-ene to n-butyliodide
(xiii) 2-Chloropropane to 1-propanol
(xiv) Isopropyl alcohol to iodoform
(xv) Chlorobenzene to p-nitrophenol
(xvi) 2-Bromopropane to 1-bromopropane
(xvii) Chloroethane to butane
(xviii) Benzene to diphenyl
(xix) tert-Butyl bromide to isobutyl bromide
(xx) Aniline to phenylisocyanide
What happens when
(i) n-butyl chloride is treated with alcoholic KOH,
(ii) bromobenzene is treated with Mg in the presence of dry ether,
(iii) chlorobenzene is subjected to hydrolysis,
(iv) ethyl chloride is treated with aqueous KOH,
(v) methyl bromide is treated with sodium in the presence of dry ether,
(vi) methyl chloride is treated with KCN.
Among the isomeric alkanes of molecular formula C5H12, identify the one that on photochemical chlorination yields
(i) A single monochloride.
(ii) Three isomeric monochlorides.
(iii) Four isomeric monochlorides.
Write structures of different dihalogen derivatives of propane.
Arrange the compounds of each set in order of reactivity towards SN2 displacement:
(i) 2-Bromo-2-methylbutane, 1-Bromopentane, 2-Bromopentane
(ii) 1-Bromo-3-methylbutane, 2-Bromo-2-methylbutane, 3-Bromo-2- methylbutane
(iii) 1-Bromobutane, 1-Bromo-2,2-dimethylpropane, 1-Bromo-2-methylbutane, 1-Bromo-3-methylbutane.
The treatment of alkyl chlorides with aqueous KOH leads to the formation of alcohols but in the presence of alcoholic KOH, alkenes are major products. Explain.
Primary alkyl halide C4H9Br (a) reacted with alcoholic KOH to give compound (b).Compound (b) is reacted with HBr to give (c) which is an isomer of (a). When (a) is reacted with sodium metal it gives compound (d), C8H18 which is different from the compound formed when n-butyl bromide is reacted with sodium. Give the structural formula of (a) and write the equations for all the reactions.
Which one of the following has the highest dipole moment?
(i) CH2Cl2
(ii) CHCl3
(iii) CCl4
Why is sulphuric acid not used during the reaction of alcohols with KI?
In the following pairs of halogen compounds, which compound undergoes faster SN1 reaction?
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
How many ions are produced from the complex Co(NH3)6Cl2 in solution?
(i) 6
(ii) 4
(iii) 3
(iv) 2
Why is BiH3 the strongest reducing agent amongst all the hydrides of Group 15 elements?
Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?
Copper crystallises into a fcc lattice with edge length 3.61 x 10-8cm. Show that the calculated density is in agreement with its measured value of 8.92 g cm-3.
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Why is the ester hydrolysis slow in the beginning and becomes faster after sometime?
A first order reaction takes 40 min for 30% decomposition. Calculate t1/2.
The conversion of molecules X to Y follows second order kinetics. If concentration of X is increased to three times how will it affect the rate of formation of Y?
Complete the following acid-base reactions and name the products:
(i) CH3CH2CH2NH2 + HCl →
(ii) (C2H5)3N + HCl →
Explain
(i) The basis of similarities and differences between metallic and ionic crystals.
(ii) Ionic solids are hard and brittle.
Thank u for the helpâºï¸
Thanks its useful
It is helpful for me
Helpful that is..
thanks a lot
Questions 5 is missing plz upload
Thanks a lot just give the region and there boiling points
S in bromoform increase in the branching decreases the boiling pt
thanks
Please arrange the boiling point order of 1chloropentane ,2chloropentane ,3chloropentane