Arrange the compounds of each set in order of reactivity towards SN2 displacement:
(i) 2-Bromo-2-methylbutane, 1-Bromopentane, 2-Bromopentane
(ii) 1-Bromo-3-methylbutane, 2-Bromo-2-methylbutane, 3-Bromo-2- methylbutane
(iii) 1-Bromobutane, 1-Bromo-2,2-dimethylpropane, 1-Bromo-2-methylbutane, 1-Bromo-3-methylbutane.
(i)
An SN2 reaction involves the approaching of the nucleophile to the carbon atom to which the leaving group is attached. When the nucleophile is sterically hindered, then the reactivity towards SN2 displacement decreases. Due to the presence of substituents, hindrance to the approaching nucleophile increases in the following order.
1-Bromopentane < 2-bromopentane < 2-Bromo-2-methylbutane
Hence, the increasing order of reactivity towards SN2 displacement is:
2-Bromo-2-methylbutane < 2-Bromopentane < 1-Bromopentane
(ii)
Since steric hindrance in alkyl halides increases in the order of 1° < 2° < 3°, the increasing order of reactivity towards SN2 displacement is 3° < 2° < 1°.
Hence, the given set of compounds can be arranged in the increasing order of their reactivity towards SN2 displacement as:
2-Bromo-2-methylbutane < 2-Bromo-3-methylbutane < 1-Bromo-3-methylbutane
[2-Bromo-3-methylbutane is incorrectly given in NCERT]
(iii)
The steric hindrance to the nucleophile in the SN2 mechanism increases with a decrease in the distance of the substituents from the atom containing the leaving group. Further, the steric hindrance increases with an increase in the number of substituents. Therefore, the increasing order of steric hindrances in the given compounds is as below:
1-Bromobutane < 1-Bromo-3-methylbutane < 1-Bromo-2-methylbutane
< 1-Bromo-2, 2-dimethylpropane
Hence, the increasing order of reactivity of the given compounds towards SN2 displacement is:
1-Bromo-2, 2-dimethylpropane < 1-Bromo-2-methylbutane < 1-Bromo-3- methylbutane < 1-Bromobutane
How the following conversions can be carried out?
(i) Propene to propan-1-ol
(ii) Ethanol to but-1-yne
(iii) 1-Bromopropane to 2-bromopropane
(iv) Toluene to benzyl alcohol
(v) Benzene to 4-bromonitrobenzene
(vi) Benzyl alcohol to 2-phenylethanoic acid
(vii) Ethanol to propanenitrile
(viii) Aniline to chlorobenzene
(ix) 2-Chlorobutane to 3, 4-dimethylhexane
(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane
(xi) Ethyl chloride to propanoic acid
(xii) But-1-ene to n-butyliodide
(xiii) 2-Chloropropane to 1-propanol
(xiv) Isopropyl alcohol to iodoform
(xv) Chlorobenzene to p-nitrophenol
(xvi) 2-Bromopropane to 1-bromopropane
(xvii) Chloroethane to butane
(xviii) Benzene to diphenyl
(xix) tert-Butyl bromide to isobutyl bromide
(xx) Aniline to phenylisocyanide
Arrange each set of compounds in order of increasing boiling points.
(i) Bromomethane, Bromoform, Chloromethane, Dibromomethane.
(ii) 1-Chloropropane, Isopropyl chloride, 1-Chlorobutane.
What happens when
(i) n-butyl chloride is treated with alcoholic KOH,
(ii) bromobenzene is treated with Mg in the presence of dry ether,
(iii) chlorobenzene is subjected to hydrolysis,
(iv) ethyl chloride is treated with aqueous KOH,
(v) methyl bromide is treated with sodium in the presence of dry ether,
(vi) methyl chloride is treated with KCN.
Among the isomeric alkanes of molecular formula C5H12, identify the one that on photochemical chlorination yields
(i) A single monochloride.
(ii) Three isomeric monochlorides.
(iii) Four isomeric monochlorides.
Write structures of different dihalogen derivatives of propane.
The treatment of alkyl chlorides with aqueous KOH leads to the formation of alcohols but in the presence of alcoholic KOH, alkenes are major products. Explain.
Primary alkyl halide C4H9Br (a) reacted with alcoholic KOH to give compound (b).Compound (b) is reacted with HBr to give (c) which is an isomer of (a). When (a) is reacted with sodium metal it gives compound (d), C8H18 which is different from the compound formed when n-butyl bromide is reacted with sodium. Give the structural formula of (a) and write the equations for all the reactions.
Which one of the following has the highest dipole moment?
(i) CH2Cl2
(ii) CHCl3
(iii) CCl4
Why is sulphuric acid not used during the reaction of alcohols with KI?
In the following pairs of halogen compounds, which compound undergoes faster SN1 reaction?
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Copper crystallises into a fcc lattice with edge length 3.61 x 10-8cm. Show that the calculated density is in agreement with its measured value of 8.92 g cm-3.
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Why is the ester hydrolysis slow in the beginning and becomes faster after sometime?
A first order reaction takes 40 min for 30% decomposition. Calculate t1/2.
The conversion of molecules X to Y follows second order kinetics. If concentration of X is increased to three times how will it affect the rate of formation of Y?
Complete the following acid-base reactions and name the products:
(i) CH3CH2CH2NH2 + HCl →
(ii) (C2H5)3N + HCl →
Explain
(i) The basis of similarities and differences between metallic and ionic crystals.
(ii) Ionic solids are hard and brittle.
Explain the bonding in coordination compounds in terms of Werner’s postulates.
An element with molar mass 2.7 x 10-2kg mol-1 forms a cubic unit cell with edge length 405 pm. If its density is 2.7 x 103 kg m-3, what is the nature of the cubic unit cell?
The decomposition of A into product has value of k as 4.5 x 103 s-1 at 10°C and energy of activation 60 kJ mol-1. At what temperature would k be 1.5 x 104 s-1?
Good job for stidentsr
A useful information has been provided unto me, thank so much