What is glycogen? How is it different from starch?

Give simple chemical tests to distinguish between the following pairs of compounds.

(i) Propanal and Propanone

(ii) Acetophenone and Benzophenone

(iii) Phenol and Benzoic acid

(iv) Benzoic acid and Ethyl benzoate

(v) Pentan-2-one and Pentan-3-one

(vi) Benzaldehyde and Acetophenone

(vii) Ethanal and Propanal

Henry's law constant for CO₂ in water is 1.67 x 10⁸Pa at 298 K. Calculate the quantity of CO₂in 500 mL of soda water when packed under 2.5 atm CO₂ pressure at 298 K.

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.

A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL^-1, then what shall be the molarity of the solution?

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

H₂S, a toxic gas with rotten egg like smell, is used for the qualitative analysis. If the solubility of H₂S in water at STP is 0.195 m, calculate Henry's law constant.

A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.

Calculate the mass of urea (NH₂CONH₂) required in making 2.5 kg of 0.25 molal aqueous solution.

Calculate the mass of a non-volatile solute (molar mass 40 g mol^-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.

Write the Nernst equation and emf of the following cells at 298 K:

(i) Mg(s) | Mg²⁺(0.001M) || Cu²⁺(0.0001 M) | Cu(s)

(ii) Fe(s) | Fe²⁺(0.001M) || H⁺(1M)|H₂(g)(1bar) | Pt(s)

(iii) Sn(s) | Sn²⁺(0.050 M) || H⁺(0.020 M) | H₂(g) (1 bar) | Pt(s)

(iv) Pt(s) | Br₂(l) | Br^-(0.010 M) || H⁺(0.030 M) | H₂(g) (1 bar) | Pt(s).

Explain what is observed

(i) When a beam of light is passed through a colloidal sol.

(ii) An electrolyte, NaCl is added to hydrated ferric oxide sol.

(iii) Electric current is passed through a colloidal sol?

Aluminium crystallises in a cubic close-packed structure. Its metallic radius is 125 pm.

(i) What is the length of the side of the unit cell?

(ii) How many unit cells are there in 1.00 cm3of aluminium?

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

Give equations of the following reactions:

(i) Oxidation of propan-1-ol with alkaline KMnO₄ solution.

(ii) Bromine in CS₂ with phenol.

(iii) Dilute HNO₃ with phenol.

(iv) Treating phenol with chloroform in presence of aqueous NaOH.

How do you explain the absence of aldehyde group in the pentaacetate of D-glucose?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

An element with molar mass 2.7 x 10^-2kg mol^-1 forms a cubic unit cell with edge length 405 pm. If its density is 2.7 x 10³ kg m^-3, what is the nature of the cubic unit cell?

What are the oxidation states of phosphorus in the following:

(i) H₃PO₃

(ii) PCl₃

(iii) Ca₃P₂

(iv) Na₃PO₄

(v) POF₃?

The activation energy for the reaction 2HI_(g) → H₂ + I_2(g) is 209.5 kJ mol^-1 at 581 K. Calculate the fraction of molecules of reactants having energy equal to or greater than activation energy?