Class 12 Chemistry - Chapter Chemical Kinetics NCERT Solutions | The decomposition of A into product has

The half-life for radioactive decay of ¹⁴C is 5730 years. An archaeological artifact containing wood had only 80% of the ¹⁴C found in a living tree. Estimate the age of the sample.

For a first order reaction, show that time required for 99% completion is twice the time required for the completion of 90% of reaction.

The rate of a reaction quadruples when the temperature changes from 293 K to 313 K. Calculate the energy of activation of the reaction assuming that it does not change with temperature.

A first order reaction takes 40 min for 30% decomposition. Calculate t_1/2.

In a reaction, 2A → Products, the concentration of A decreases from 0.5 mol L^-1 to 0.4 mol L^-1 in 10 minutes. Calculate the rate during this interval?

The conversion of molecules X to Y follows second order kinetics. If concentration of X is increased to three times how will it affect the rate of formation of Y?

During nuclear explosion, one of the products is ⁹⁰Sr with half-life of 28.1 years. If 1μg of ⁹⁰Sr was absorbed in the bones of a newly born baby instead of calcium, how much of it will remain after 10 years and 60 years if it is not lost metabolically.

Sucrose decomposes in acid solution into glucose and fructose according to the first order rate law, with t_1/2 = 3.00 hours. What fraction of sample of sucrose remains after 8 hours?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

The following data were obtained during the first order thermal decomposition of SO₂Cl₂at a constant volume.

SO₂Cl₂₍g)  →  SO₂₍g) + Cl₂(g)

Calculate the rate of the reaction when total pressure is 0.65 atm.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

Explain the difference between Buna-N and Buna-S.

Describe the manufacture of H₂SO₄ by contact process?

Suppose a solid solution is formed between two substances, one whose particles are very large and the other whose particles are very small. What kind of solid solution is this likely to be?

Mention the conditions required to maximise the yield of ammonia.

Explain giving reasons:

(i) Transition metals and many of their compounds show paramagnetic behaviour.

(ii) The enthalpies of atomisation of the transition metals are high.

(iii) The transition metals generally form coloured compounds.

(iv) Transition metals and their many compounds act as good catalyst.

Write the Nernst equation and emf of the following cells at 298 K:

(i) Mg(s) | Mg²⁺(0.001M) || Cu²⁺(0.0001 M) | Cu(s)

(ii) Fe(s) | Fe²⁺(0.001M) || H⁺(1M)|H₂(g)(1bar) | Pt(s)

(iii) Sn(s) | Sn²⁺(0.050 M) || H⁺(0.020 M) | H₂(g) (1 bar) | Pt(s)

(iv) Pt(s) | Br₂(l) | Br^-(0.010 M) || H⁺(0.030 M) | H₂(g) (1 bar) | Pt(s).

Classify the following as amorphous or crystalline solids:
Polyurethane, naphthalene, benzoic acid, teflon, potassium nitrate, cellophane, polyvinyl chloride, fibre glass, copper.

Classify the following as addition and condensation polymers: Terylene, Bakelite, Polyvinyl chloride, Polythene.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p