Class 12 Chemistry - Chapter The p-Block Elements NCERT Solutions | How can you prepare Cl2 from HCl and HCl

Why is helium used in diving apparatus?

Why are pentahalides more covalent than trihalides?

Give the formula and describe the structure of a noble gas species which is isostructural with:

(i) ICl^-₄

(ii) IBr^-₂

(iii) BrO^-₃

Why is H₂O a liquid and H₂S a gas?

How is O₃ estimated quantitatively?

What happens when sulphur dioxide is passed through an aqueous solution of Fe(III) salt?

Why is BiH3 the strongest reducing agent amongst all the hydrides of Group 15 elements?

Why are halogens strong oxidising agents?

Arrange the following in the order of property indicated for each set:

(i) F₂, Cl₂, Br₂, I₂- increasing bond dissociation enthalpy.

(ii) HF, HCl, HBr, HI - increasing acid strength.

(iii) NH₃, PH₃, AsH₃, SbH₃, BiH₃- increasing base strength.

Comment on the nature of two S-O bonds formed in SO₂ molecule. Are the two S-O bonds in this molecule equal?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

List various types of isomerism possible for coordination compounds, giving an example of each.

Write chemical reaction for the preparation of phenol from chlorobenzene.

How much charge is required for the following reductions:

(i) 1 mol of Al³⁺ to Al.

(ii) 1 mol of Cu²⁺ to Cu.

(iii) 1 mol of MnO₄^- to Mn²⁺.

What are the hydrolysis products of (i)sucrose and (ii)lactose?

In the series Sc (Z = 21) to Zn (Z = 30), the enthalpy of atomization of zinc is the lowest, i.e., 126 kJ mol−1. Why?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Discuss the nature of bonding in metal carbonyls.

How will you convert ethanal into the following compounds?

(i) Butane-1, 3-diol  (ii) But-2-enal  (iii) But-2-enoic acid

The rate of a reaction quadruples when the temperature changes from 293 K to 313 K. Calculate the energy of activation of the reaction assuming that it does not change with temperature.