Explain the following with an example.
(i) Kolbe's reaction.
(ii) Reimer-Tiemann reaction.
(iii) Williamson ether synthesis.
(iv) Unsymmetrical ether.
(i) Kolbe's reaction:
When phenol is treated with sodium hydroxide, sodium phenoxide is produced. This sodium phenoxide when treated with carbon dioxide, followed by acidification, undergoes electrophilic substitution to give ortho-hydroxybenzoic acid as the main product. This reaction is known as Kolbe's reaction.
(ii) Reimer-Tiemann reaction:
When phenol is treated with chloroform (CHCl3) in the presence of sodium hydroxide, a -CHO group is introduced at the ortho position of the benzene ring.
This reaction is known as the Reimer-Tiemann reaction.
The intermediate is hydrolyzed in the presence of alkalis to produce salicyclaldehyde.
(iii) Williamson ether synthesis:
Williamson ether synthesis is a laboratory method to prepare symmetrical and unsymmetrical ethers by allowing alkyl halides to react with sodium alkoxides.
This reaction involves SN2 attack of the alkoxide ion on the alkyl halide. Better results are obtained in case of primary alkyl halides.
If the alkyl halide is secondary or tertiary, then elimination competes over substitution.
(iv) Unsymmetrical ether:
An unsymmetrical ether is an ether where two groups on the two sides of an oxygen atom differ (i.e., have an unequal number of carbon atoms). For example: ethyl methyl ether (CH3-O-CH2CH3).
How are the following conversions carried out?
(i) Propene → Propan-2-ol
(ii) Benzyl chloride → Benzyl alcohol
(iii) Ethyl magnesium chloride → Propan-1-ol.
(iv) Methyl magnesium bromide → 2-Methylpropan-2-ol.
Write the mechanism of acid-catalysed dehydration of ethanol to yield ethene.
Give the equations of reactions for the preparation of phenol from cumene.
Write equations of the following reactions:
(i) Friedel-Crafts reaction-alkylation of anisole.
(ii) Nitration of anisole.
(iii) Bromination of anisole in ethanoic acid medium.
(iv) Friedel-Craft's acetylation of anisole.
Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?
Give two reactions that show the acidic nature of phenol. Compare acidity of phenol with that of ethanol.
Show how are the following alcohols prepared by the reaction of a suitable
Grignard reagent on methanal?
(i)
(ii)
Write the reactions of Williamson synthesis of 2-ethoxy-3-methylpentane starting from ethanol and 3-methylpentan-2-ol.
What is meant by hydroboration-oxidation reaction? Illustrate it with an example.
Give structures of the products you would expect when each of the following alcohol reacts with (a) HCl-ZnCl2 (b) HBr and (c) SOCl2.
(i) Butan-1-ol
(ii) 2-Methylbutan-2-ol
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
What are polymers?
The reaction between A and B is first order with respect to A and zero order with respect to B. Fill in the blanks in the following table:
Experiment |
A/ mol L - 1 |
B/ mol L - 1 |
Initial rate/mol L - 1 min - 1 |
I | 0.1 | 0.1 |
2.0 × 10 - 2 |
II | -- | 0.2 |
4.0 × 10 - 2 |
III | 0.4 | 0.4 | -- |
IV | -- | 0.2 |
2.0 × 10 - 2 |
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Show how each of the following compounds can be converted to benzoic acid.
(i) Ethylbenzene (ii) Acetophenone
(iii) Bromobenzene (iv) Phenylethene (Styrene)
Predict the products of the following reactions:
(i)
(ii)
(iii)
(iv)
Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions.
(i)Ethanal, Propanal, Propanone, Butanone.
(ii)Benzaldehyde, p-Tolualdehyde, p-Nitrobenzaldehyde, Acetophenone.
Hint:Consider steric effect and electronic effect.
Arrange the following compounds in increasing order of their boiling points.
CH3CHO, CH3CH2OH, CH3OCH3, CH3CH2CH3
The resistance of a conductivity cell containing 0.001M KCl solution at 298 K is 1500 Ω. What is the cell constant if conductivity of 0.001M KCl solution at 298 K is 0.146 x 10-3 S cm-1.
How are colloids classified on the basis of
(i) Physical states of components
(ii) Nature of dispersion medium and
(iii) Interaction between dispersed phase and dispersion medium?
Discuss the trends in chemical reactivity of group 15 elements.
V effective answers