Class 12 Chemistry - Chapter Alcohols Phenols and Ethers NCERT Solutions | Write the reactions of Williamson synthe

Explain the following with an example.

(i) Kolbe's reaction.

(ii) Reimer-Tiemann reaction.

(iii) Williamson ether synthesis.

(iv) Unsymmetrical ether.

How are the following conversions carried out?

(i) Propene → Propan-2-ol

(ii) Benzyl chloride → Benzyl alcohol

(iii) Ethyl magnesium chloride → Propan-1-ol.

(iv) Methyl magnesium bromide → 2-Methylpropan-2-ol.

Write the mechanism of acid-catalysed dehydration of ethanol to yield ethene.

Give the equations of reactions for the preparation of phenol from cumene.

Write equations of the following reactions:

(i) Friedel-Crafts reaction-alkylation of anisole.

(ii) Nitration of anisole.

(iii) Bromination of anisole in ethanoic acid medium.

(iv) Friedel-Craft's acetylation of anisole.

Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?

Give two reactions that show the acidic nature of phenol. Compare acidity of phenol with that of ethanol.

Show how are the following alcohols prepared by the reaction of a suitable

Grignard reagent on methanal?

(i)

(ii)

What is meant by hydroboration-oxidation reaction? Illustrate it with an example.

Give structures of the products you would expect when each of the following alcohol reacts with (a) HCl-ZnCl₂ (b) HBr and (c) SOCl₂.

(i) Butan-1-ol

(ii) 2-Methylbutan-2-ol

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

What are natural and synthetic polymers? Give two examples of each type.

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

For a first order reaction, show that time required for 99% completion is twice the time required for the completion of 90% of reaction.

What is the difference between physisorption and chemisorption?

Among the isomeric alkanes of molecular formula C₅H₁₂, identify the one that on photochemical chlorination yields

(i) A single monochloride.

(ii) Three isomeric monochlorides.

(iii) Four isomeric monochlorides.

The melting points and solubility in water of amino acids are generally higher than that of the corresponding halo acids. Explain.

Give the formula and describe the structure of a noble gas species which is isostructural with:

(i) ICl^-₄

(ii) IBr^-₂

(iii) BrO^-₃

Write the reactions of (i) aromatic and (ii) aliphatic primary amines with nitrous acid.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Write all the geometrical isomers of [Pt(NH₃)(Br)(Cl)(py)] and how many of these will exhibit optical isomers?