Class 12 Chemistry - Chapter The p-Block Elements NCERT Solutions | Discuss the general characteristics of G
Discuss the general characteristics of Group 15 elements with reference to their electronic configuration, oxidation state, atomic size, ionisation enthalpy and electronegativity.
General trends in group 15 elements
(i) Electronic configuration: All the elements in group 15 have 5 valence electrons. Their general electronic configuration is ns2 np3.
(ii) Oxidation states: All these elements have 5 valence electrons and require three more electrons to complete their octets. However, gaining electrons is very difficult as the nucleus will have to attract three more electrons. This can take place only with nitrogen as it is the smallest in size and the distance between the nucleus and the valence shell is relatively small. The remaining elements of this group show a formal oxidation state of -3 in their covalent compounds. In addition to the -3 state, N and P also show -1 and -2 oxidation states.
All the elements present in this group show +3 and +5 oxidation states. However, the stability of +5 oxidation state decreases down a group, whereas the stability of +3 oxidation state increases. This happens because of the inert pair effect.
(iii) Ionization energy and electronegativity:
First ionization decreases on moving down a group. This is because of increasing atomic sizes. As we move down a group, electronegativity decreases, owing to an increase in size.
(iv) Atomic size: On moving down a group, the atomic size increases. This increase in the atomic size is attributed to an increase in the number of shells.
More Questions From Class 12 Chemistry - Chapter The p-Block Elements
- Q:-
Why is helium used in diving apparatus?
- Q:-
Why are pentahalides more covalent than trihalides?
- Q:-
Give the formula and describe the structure of a noble gas species which is isostructural with:
(i) ICl-4
(ii) IBr-2
(iii) BrO-3
- Q:-
Why is H2O a liquid and H2S a gas?
- Q:-
How is O3 estimated quantitatively?
- Q:-
What happens when sulphur dioxide is passed through an aqueous solution of Fe(III) salt?
- Q:-
Why is BiH3 the strongest reducing agent amongst all the hydrides of Group 15 elements?
- Q:-
Why are halogens strong oxidising agents?
- Q:-
Arrange the following in the order of property indicated for each set:
(i) F2, Cl2, Br2, I2- increasing bond dissociation enthalpy.
(ii) HF, HCl, HBr, HI - increasing acid strength.
(iii) NH3, PH3, AsH3, SbH3, BiH3- increasing base strength.
- Q:-
Comment on the nature of two S-O bonds formed in SO2 molecule. Are the two S-O bonds in this molecule equal?
Popular Questions of Class 12 Chemistry
- Q:-
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
- Q:-
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
- Q:-
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
- Q:-
Why are solids rigid?
- Q:-
Write any two characteristics of Chemisorption.
- Q:-
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
- Q:-
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
- Q:-
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
- Q:-
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
- Q:-
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
Recently Viewed Questions of Class 12 Chemistry
- Q:-
How do you explain the amphoteric behaviour of amino acids?
- Q:-
What is the coordination entity formed when excess of aqueous KCN is added to an aqueous solution of copper sulphate? Why is it that no precipitate of copper sulphide is obtained when H2S(g) is passed through this solution?
- Q:-
Which of the following is an appropriate set of reactants for the preparation of 1-methoxy-4-nitrobenzene and why?
- Q:-
Give simple chemical tests to distinguish between the following pairs of compounds.
(i) Propanal and Propanone
(ii) Acetophenone and Benzophenone
(iii) Phenol and Benzoic acid
(iv) Benzoic acid and Ethyl benzoate
(v) Pentan-2-one and Pentan-3-one
(vi) Benzaldehyde and Acetophenone
(vii) Ethanal and Propanal
- Q:-
19.5 g of CH2FCOOH is dissolved in 500 g of water. The depression in the freezing point of water observed is 1.0°C. Calculate the van't Hoff factor and dissociation constant of fluoroacetic acid.
- Q:-
What criterion is followed for the selection of the stationary phase in chromatography?
- Q:-
Calculate the standard cell potentials of galvanic cells in which the following reactions take place:
(i) 2Cr(s) + 3Cd2+(aq) → 2Cr3+(aq) + 3Cd
(ii) Fe2+(aq) + Ag+(aq) → Fe3+(aq) + Ag(s)
Calculate the ΔrGø¸ and equilibrium constant of the reactions.
- Q:-
Write IUPAC names of the following compounds:
- Q:-
Write down the IUPAC name for each of the following complexes and indicate the oxidation state, electronic configuration and coordination number. Also give stereochemistry and magnetic moment of the complex:
(i) K[Cr(H2O)2(C2O4)2].3H2O
(ii) [Co(NH3)5Cl]Cl2
(iii) CrCl3(py)3
(iv) Cs[FeCl4]
(v) K4[Mn(CN)6]
- Q:-
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
2 Comment(s) on this Question
Thanks
Thnx
- All Chapters Of Class 12 Chemistry
- All Subjects Of Class 12