Class 12 Chemistry - Chapter The Solid State NCERT Solutions | An element with molar mass 2.7 x 10-2kg

If NaCl is doped with 10^-3mol % of SrCl₂, what is the concentration of cation vacancies?

A cubic solid is made of two elements P and Q. Atoms of Q are at the corners of the cube and P at the body-centre. What is the formula of the compound? What are the coordination numbers of P and Q?

Copper crystallises into a fcc lattice with edge length 3.61 x 10^-8cm. Show that the calculated density is in agreement with its measured value of 8.92 g cm^-3.

A compound is formed by two elements M and N. The element N forms ccp and atoms of M occupy 1/3^rd of tetrahedral voids. What is the formula of the compound?

Aluminium crystallises in a cubic close-packed structure. Its metallic radius is 125 pm.

(i) What is the length of the side of the unit cell?

(ii) How many unit cells are there in 1.00 cm3of aluminium?

Analysis shows that nickel oxide has the formula Ni_0.98 O_1.00. What fractions of nickel exist as Ni²⁺and Ni³⁺ions?

Distinguish between

(i)Hexagonal and monoclinic unit cells

(ii) Face-centred and end-centred unit cells.

Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?

Ionic solids, which have anionic vacancies due to metal excess defect, develop colour. Explain with the help of a suitable example.

How will you distinguish between the following pairs of terms:

(i) Hexagonal close-packing and cubic close-packing?

(ii) Crystal lattice and unit cell?

(iii) Tetrahedral void and octahedral void?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

The rate constant for the first order decomposition of H₂O₂ is given by the following equation:

log k = 14.34 - 1.25 x 10⁴ K/T

Calculate E_a for this reaction and at what temperature will its half-period be 256 minutes?

Explain the difference between Buna-N and Buna-S.

Describe the manufacture of H₂SO₄ by contact process?

Suppose a solid solution is formed between two substances, one whose particles are very large and the other whose particles are very small. What kind of solid solution is this likely to be?

Mention the conditions required to maximise the yield of ammonia.

Explain giving reasons:

(i) Transition metals and many of their compounds show paramagnetic behaviour.

(ii) The enthalpies of atomisation of the transition metals are high.

(iii) The transition metals generally form coloured compounds.

(iv) Transition metals and their many compounds act as good catalyst.

Write the Nernst equation and emf of the following cells at 298 K:

(i) Mg(s) | Mg²⁺(0.001M) || Cu²⁺(0.0001 M) | Cu(s)

(ii) Fe(s) | Fe²⁺(0.001M) || H⁺(1M)|H₂(g)(1bar) | Pt(s)

(iii) Sn(s) | Sn²⁺(0.050 M) || H⁺(0.020 M) | H₂(g) (1 bar) | Pt(s)

(iv) Pt(s) | Br₂(l) | Br^-(0.010 M) || H⁺(0.030 M) | H₂(g) (1 bar) | Pt(s).

Classify the following as addition and condensation polymers: Terylene, Bakelite, Polyvinyl chloride, Polythene.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

What are inner transition elements? Decide which of the following atomic numbers are the atomic numbers of the inner transition elements: 29, 59, 74, 95, 102, 104.