Class 12 Chemistry - Chapter Electrochemistry NCERT Solutions | Calculate the potential of hydrogen elec

If a current of 0.5 ampere flows through a metallic wire for 2 hours, then how many electrons would flow through the wire?

Calculate the emf of the cell in which the following reaction takes place:

Ni_(s) + 2Ag⁺ (0.002 M) → Ni²⁺ (0.160 M) + 2Ag_(s)

Given that E^ø_cell = 1.05 V

Depict the galvanic cell in which the reaction Zn(s) + 2Ag⁺(aq) → Zn²⁺(aq) + 2Ag(s) takes place.

Further show:

(i) Which of the electrode is negatively charged?

(ii) The carriers of the current in the cell.

(iii) Individual reaction at each electrode.

Calculate the standard cell potentials of galvanic cells in which the following reactions take place:

(i) 2Cr(s) + 3Cd²⁺(aq) → 2Cr³⁺(aq) + 3Cd

(ii) Fe²⁺(aq) + Ag+(aq) → Fe³⁺(aq) + Ag(s)

Calculate the ΔrG^ø¸ and equilibrium constant of the reactions.

Write the Nernst equation and emf of the following cells at 298 K:

(i) Mg(s) | Mg²⁺(0.001M) || Cu²⁺(0.0001 M) | Cu(s)

(ii) Fe(s) | Fe²⁺(0.001M) || H⁺(1M)|H₂(g)(1bar) | Pt(s)

(iii) Sn(s) | Sn²⁺(0.050 M) || H⁺(0.020 M) | H₂(g) (1 bar) | Pt(s)

(iv) Pt(s) | Br₂(l) | Br^-(0.010 M) || H⁺(0.030 M) | H₂(g) (1 bar) | Pt(s).

Define conductivity and molar conductivity for the solution of an electrolyte. Discuss their variation with concentration.

How would you determine the standard electrode potential of the system Mg²⁺ | Mg?

Predict the products of electrolysis in each of the following:

(i) An aqueous solution of AgNO₃ with silver electrodes.

(ii) An aqueous solution of AgNO₃with platinum electrodes.

(iii) A dilute solution of H₂SO₄with platinum electrodes.

(iv) An aqueous solution of CuCl₂ with platinum electrodes.

A solution of Ni(NO₃)₂ is electrolysed between platinum electrodes using a current of 5 amperes for 20 minutes. What mass of Ni is deposited at the cathode?

The resistance of a conductivity cell containing 0.001M KCl solution at 298 K is 1500 Ω. What is the cell constant if conductivity of 0.001M KCl solution at 298 K is 0.146 x 10^-3 S cm^-1.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Analysis shows that nickel oxide has the formula Ni_0.98 O_1.00. What fractions of nickel exist as Ni²⁺and Ni³⁺ions?

The rate of a reaction quadruples when the temperature changes from 293 K to 313 K. Calculate the energy of activation of the reaction assuming that it does not change with temperature.

Arrange each set of compounds in order of increasing boiling points.

(i) Bromomethane, Bromoform, Chloromethane, Dibromomethane.

(ii) 1-Chloropropane, Isopropyl chloride, 1-Chlorobutane.

How many ions are produced from the complex Co(NH₃)₆Cl₂ in solution?

(i) 6

(ii) 4

(iii) 3

(iv) 2

Why is BiH3 the strongest reducing agent amongst all the hydrides of Group 15 elements?

Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?

Arrange the compounds of each set in order of reactivity towards SN2 displacement:

(i) 2-Bromo-2-methylbutane, 1-Bromopentane, 2-Bromopentane

(ii) 1-Bromo-3-methylbutane, 2-Bromo-2-methylbutane, 3-Bromo-2- methylbutane

(iii) 1-Bromobutane, 1-Bromo-2,2-dimethylpropane, 1-Bromo-2-methylbutane, 1-Bromo-3-methylbutane.

Copper crystallises into a fcc lattice with edge length 3.61 x 10^-8cm. Show that the calculated density is in agreement with its measured value of 8.92 g cm^-3.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Why is the ester hydrolysis slow in the beginning and becomes faster after sometime?