In terms of band theory, what is the difference
(i) Between a conductor and an insulator
(ii) Between a conductor and a semiconductor
(i) In a conductor the energy gap is either very small or there is overlapping between valence band and conduction band. In case of an insulator the energy gap between valence band and conduction band is very large. Due to which, when an electric field is applied to an insulator, the electrons cannot jump from valence band to conduction band, hence poor or no conduction of electricity.
(ii) In a conductor, the energy gap between valence band and conduction band is very small but in an semiconductor there is always a small energy gap between them.
If NaCl is doped with 10-3mol % of SrCl2, what is the concentration of cation vacancies?
A cubic solid is made of two elements P and Q. Atoms of Q are at the corners of the cube and P at the body-centre. What is the formula of the compound? What are the coordination numbers of P and Q?
An element with molar mass 2.7 x 10-2kg mol-1 forms a cubic unit cell with edge length 405 pm. If its density is 2.7 x 103 kg m-3, what is the nature of the cubic unit cell?
Copper crystallises into a fcc lattice with edge length 3.61 x 10-8cm. Show that the calculated density is in agreement with its measured value of 8.92 g cm-3.
A compound is formed by two elements M and N. The element N forms ccp and atoms of M occupy 1/3rd of tetrahedral voids. What is the formula of the compound?
Aluminium crystallises in a cubic close-packed structure. Its metallic radius is 125 pm.
(i) What is the length of the side of the unit cell?
(ii) How many unit cells are there in 1.00 cm3of aluminium?
Analysis shows that nickel oxide has the formula Ni0.98 O1.00. What fractions of nickel exist as Ni2+and Ni3+ions?
Distinguish between
(i)Hexagonal and monoclinic unit cells
(ii) Face-centred and end-centred unit cells.
Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?
Ionic solids, which have anionic vacancies due to metal excess defect, develop colour. Explain with the help of a suitable example.
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
How do you explain the amphoteric behaviour of amino acids?
What is the coordination entity formed when excess of aqueous KCN is added to an aqueous solution of copper sulphate? Why is it that no precipitate of copper sulphide is obtained when H2S(g) is passed through this solution?
Which of the following is an appropriate set of reactants for the preparation of 1-methoxy-4-nitrobenzene and why?
Give simple chemical tests to distinguish between the following pairs of compounds.
(i) Propanal and Propanone
(ii) Acetophenone and Benzophenone
(iii) Phenol and Benzoic acid
(iv) Benzoic acid and Ethyl benzoate
(v) Pentan-2-one and Pentan-3-one
(vi) Benzaldehyde and Acetophenone
(vii) Ethanal and Propanal
19.5 g of CH2FCOOH is dissolved in 500 g of water. The depression in the freezing point of water observed is 1.0°C. Calculate the van't Hoff factor and dissociation constant of fluoroacetic acid.
What criterion is followed for the selection of the stationary phase in chromatography?
Calculate the standard cell potentials of galvanic cells in which the following reactions take place:
(i) 2Cr(s) + 3Cd2+(aq) → 2Cr3+(aq) + 3Cd
(ii) Fe2+(aq) + Ag+(aq) → Fe3+(aq) + Ag(s)
Calculate the ΔrGø¸ and equilibrium constant of the reactions.
Write IUPAC names of the following compounds:
Write down the IUPAC name for each of the following complexes and indicate the oxidation state, electronic configuration and coordination number. Also give stereochemistry and magnetic moment of the complex:
(i) K[Cr(H2O)2(C2O4)2].3H2O
(ii) [Co(NH3)5Cl]Cl2
(iii) CrCl3(py)3
(iv) Cs[FeCl4]
(v) K4[Mn(CN)6]
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p